C15H25F5 — CID 20579542
13,13,14,14,14-pentafluoro-8-methyltetradec-1-ene (PubChem CID 20579542) has the molecular formula C15H25F5 and a molecular weight of 300.36 g/mol. Its IUPAC name is 13,13,14,14,14-pentafluoro-8-methyltetradec-1-ene.
| Compound Name | 13,13,14,14,14-pentafluoro-8-methyltetradec-1-ene |
|---|---|
| PubChem CID | 20579542 |
| Molecular Formula | C15H25F5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 13,13,14,14,14-pentafluoro-8-methyltetradec-1-ene |
| SMILES | C=CCCCCCC(C)CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H25F5/c1-3-4-5-6-7-10-13(2)11-8-9-12-14(16,17)15(18,19)20/h3,13H,1,4-12H2,2H3 |
| InChIKey | XDPHKFNXYYPGCB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|