C18H31F5 — CID 20579549
16,16,17,17,17-pentafluoro-9-methylheptadec-1-ene (PubChem CID 20579549) has the molecular formula C18H31F5 and a molecular weight of 342.44 g/mol. Its IUPAC name is 16,16,17,17,17-pentafluoro-9-methylheptadec-1-ene.
| Compound Name | 16,16,17,17,17-pentafluoro-9-methylheptadec-1-ene |
|---|---|
| PubChem CID | 20579549 |
| Molecular Formula | C18H31F5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 16,16,17,17,17-pentafluoro-9-methylheptadec-1-ene |
| SMILES | C=CCCCCCCC(C)CCCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H31F5/c1-3-4-5-6-7-10-13-16(2)14-11-8-9-12-15-17(19,20)18(21,22)23/h3,16H,1,4-15H2,2H3 |
| InChIKey | JGMDCJIUWLFLPO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|