About tridecyl 2-methylpent-4-enoate
tridecyl 2-methylpent-4-enoate (PubChem CID 20579575) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is tridecyl 2-methylpent-4-enoate.
Molecular Properties
| Compound Name | tridecyl 2-methylpent-4-enoate |
| PubChem CID | 20579575 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | tridecyl 2-methylpent-4-enoate |
| SMILES | C=CCC(C)C(=O)OCCCCCCCCCCCCC |
| InChI | InChI=1S/C19H36O2/c1-4-6-7-8-9-10-11-12-13-14-15-17-21-19(20)18(3)16-5-2/h5,18H,2,4,6-17H2,1,3H3 |
| InChIKey | QHJVHHWMUTUGCA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tridecyl 2-methylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecyl 2-methylpent-4-enoate?
The IUPAC name of tridecyl 2-methylpent-4-enoate (CID 20579575) is tridecyl 2-methylpent-4-enoate.
What is the SMILES notation for tridecyl 2-methylpent-4-enoate?
The canonical SMILES for tridecyl 2-methylpent-4-enoate is C=CCC(C)C(=O)OCCCCCCCCCCCCC.
What is the InChIKey of tridecyl 2-methylpent-4-enoate?
The InChIKey is QHJVHHWMUTUGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-4-6-7-8-9-10-11-12-13-14-15-17-21-19(20)18(3)16-5-2/h5,18H,2,4,6-17H2,1,3H3.
What are the key properties of tridecyl 2-methylpent-4-enoate?
tridecyl 2-methylpent-4-enoate has a molecular weight of 296.50 g/mol, XLogP of 6.05, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tridecyl 2-methylpent-4-enoate is sourced from PubChem (CID 20579575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).