C9H12ClF6NO — CID 20579832
1-[3-(chloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine (PubChem CID 20579832) has the molecular formula C9H12ClF6NO and a molecular weight of 299.64 g/mol. Its IUPAC name is 1-[3-(chloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine.
| Compound Name | 1-[3-(chloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine |
|---|---|
| PubChem CID | 20579832 |
| Molecular Formula | C9H12ClF6NO |
| Molecular Weight | 299.64 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-[3-(chloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine |
| SMILES | FC(F)(OCCl)C(F)(F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C9H12ClF6NO/c10-6-18-9(15,16)7(11,12)8(13,14)17-4-2-1-3-5-17/h1-6H2 |
| InChIKey | FJMFDAUKUWERRD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|