C9H11Cl2F6NO — CID 20579833
1-[3-(dichloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine (PubChem CID 20579833) has the molecular formula C9H11Cl2F6NO and a molecular weight of 334.09 g/mol. Its IUPAC name is 1-[3-(dichloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine.
| Compound Name | 1-[3-(dichloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine |
|---|---|
| PubChem CID | 20579833 |
| Molecular Formula | C9H11Cl2F6NO |
| Molecular Weight | 334.09 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 1-[3-(dichloromethoxy)-1,1,2,2,3,3-hexafluoropropyl]piperidine |
| SMILES | FC(F)(OC(Cl)Cl)C(F)(F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C9H11Cl2F6NO/c10-6(11)19-9(16,17)7(12,13)8(14,15)18-4-2-1-3-5-18/h6H,1-5H2 |
| InChIKey | ITHBDHCQYRBUBD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|