About 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+)
1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) (PubChem CID 20579853) has the molecular formula C16H13N2O2Y+2
and a molecular weight of 354.20 g/mol. Its IUPAC name is 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+).
Molecular Properties
| Compound Name | 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) |
| PubChem CID | 20579853 |
| Molecular Formula | C16H13N2O2Y+2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) |
| SMILES | [CH2-]Nc1ccc(NC)c2c1C(=O)c1ccccc1C2=O.[Y+3] |
| InChI | InChI=1S/C16H13N2O2.Y/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16(14)20;/h3-8,17-18H,1H2,2H3;/q-1;+3 |
| InChIKey | KRPRMGYOQBPBFK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+)?
The IUPAC name of 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) (CID 20579853) is 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+).
What is the SMILES notation for 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+)?
The canonical SMILES for 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) is [CH2-]Nc1ccc(NC)c2c1C(=O)c1ccccc1C2=O.[Y+3].
What is the InChIKey of 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+)?
The InChIKey is KRPRMGYOQBPBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N2O2.Y/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16(14)20;/h3-8,17-18H,1H2,2H3;/q-1;+3.
What are the key properties of 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+)?
1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) has a molecular weight of 354.20 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methanidylamino)-4-(methylamino)anthracene-9,10-dione;yttrium(3+) is sourced from PubChem (CID 20579853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).