About 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium)
1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) (PubChem CID 20579982) has the molecular formula C8H6F2OY11-2
and a molecular weight of 1134.10 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium).
Molecular Properties
| Compound Name | 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) |
| PubChem CID | 20579982 |
| Molecular Formula | C8H6F2OY11-2 |
| Molecular Weight | 1134.10 g/mol |
| Exact Mass | 1134.00 |
| IUPAC Name | 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) |
| SMILES | Cc1c[c-]c(OC(F)F)[c-]c1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C8H6F2O.11Y/c1-6-2-4-7(5-3-6)11-8(9)10;;;;;;;;;;;/h2-3,8H,1H3;;;;;;;;;;;/q-2;;;;;;;;;;; |
| InChIKey | CCLJMLRNIALLNK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1134.10 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium)?
The IUPAC name of 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) (CID 20579982) is 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium).
What is the SMILES notation for 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium)?
The canonical SMILES for 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) is Cc1c[c-]c(OC(F)F)[c-]c1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium)?
The InChIKey is CCLJMLRNIALLNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2O.11Y/c1-6-2-4-7(5-3-6)11-8(9)10;;;;;;;;;;;/h2-3,8H,1H3;;;;;;;;;;;/q-2;;;;;;;;;;;.
What are the key properties of 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium)?
1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) has a molecular weight of 1134.10 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethoxy)-4-methylbenzene-2,6-diide;undecakis(yttrium) is sourced from PubChem (CID 20579982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).