C34H32N2O3 — CID 20580175
4-[2-(4-hydroxyphenyl)-4-[4-(4-methyl-N-pyridin-2-ylanilino)phenoxy]butan-2-yl]phenol (PubChem CID 20580175) has the molecular formula C34H32N2O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)-4-[4-(4-methyl-N-pyridin-2-ylanilino)phenoxy]butan-2-yl]phenol.
| Compound Name | 4-[2-(4-hydroxyphenyl)-4-[4-(4-methyl-N-pyridin-2-ylanilino)phenoxy]butan-2-yl]phenol |
|---|---|
| PubChem CID | 20580175 |
| Molecular Formula | C34H32N2O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)-4-[4-(4-methyl-N-pyridin-2-ylanilino)phenoxy]butan-2-yl]phenol |
| SMILES | Cc1ccc(N(c2ccc(OCCC(C)(c3ccc(O)cc3)c3ccc(O)cc3)cc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C34H32N2O3/c1-25-6-12-28(13-7-25)36(33-5-3-4-23-35-33)29-14-20-32(21-15-29)39-24-22-34(2,26-8-16-30(37)17-9-26)27-10-18-31(38)19-11-27/h3-21,23,37-38H,22,24H2,1-2H3 |
| InChIKey | HCPABLKWZWMMOO-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |