About 2-iminopropan-1-ol
2-iminopropan-1-ol (PubChem CID 20580277) has the molecular formula C3H7NO
and a molecular weight of 73.09 g/mol. Its IUPAC name is 2-iminopropan-1-ol.
Molecular Properties
| Compound Name | 2-iminopropan-1-ol |
| PubChem CID | 20580277 |
| Molecular Formula | C3H7NO |
| Molecular Weight | 73.09 g/mol |
| Exact Mass | 73.05 |
| IUPAC Name | 2-iminopropan-1-ol |
| SMILES | [H]/N=C(\C)CO |
| InChI | InChI=1S/C3H7NO/c1-3(4)2-5/h4-5H,2H2,1H3/b4-3+ |
| InChIKey | IGCPCAOIUXKSJI-ONEGZZNKSA-N |
| XLogP | 0.02 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.09 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminopropan-1-ol?
The IUPAC name of 2-iminopropan-1-ol (CID 20580277) is 2-iminopropan-1-ol.
What is the SMILES notation for 2-iminopropan-1-ol?
The canonical SMILES for 2-iminopropan-1-ol is [H]/N=C(\C)CO.
What is the InChIKey of 2-iminopropan-1-ol?
The InChIKey is IGCPCAOIUXKSJI-ONEGZZNKSA-N. The full InChI is InChI=1S/C3H7NO/c1-3(4)2-5/h4-5H,2H2,1H3/b4-3+.
What are the key properties of 2-iminopropan-1-ol?
2-iminopropan-1-ol has a molecular weight of 73.09 g/mol, XLogP of 0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminopropan-1-ol is sourced from PubChem (CID 20580277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).