C16H12F6N2O5S — CID 20580520
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-methyl-2-nitrobenzenesulfonamide (PubChem CID 20580520) has the molecular formula C16H12F6N2O5S and a molecular weight of 458.34 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-methyl-2-nitrobenzenesulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-methyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 20580520 |
| Molecular Formula | C16H12F6N2O5S |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-methyl-2-nitrobenzenesulfonamide |
| SMILES | CN(c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12F6N2O5S/c1-23(30(28,29)13-5-3-2-4-12(13)24(26)27)11-8-6-10(7-9-11)14(25,15(17,18)19)16(20,21)22/h2-9,25H,1H3 |
| InChIKey | XUSKTQNZMCAREF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|