About 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole
5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole (PubChem CID 20580525) has the molecular formula C6H9ClN2O2S
and a molecular weight of 208.67 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole.
Molecular Properties
| Compound Name | 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole |
| PubChem CID | 20580525 |
| Molecular Formula | C6H9ClN2O2S |
| Molecular Weight | 208.67 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole |
| SMILES | Cc1nn(C)c(Cl)c1S(C)(=O)=O |
| InChI | InChI=1S/C6H9ClN2O2S/c1-4-5(12(3,10)11)6(7)9(2)8-4/h1-3H3 |
| InChIKey | JLFUZLONGTXSNC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.67 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole?
The IUPAC name of 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole (CID 20580525) is 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole.
What is the SMILES notation for 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole?
The canonical SMILES for 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole is Cc1nn(C)c(Cl)c1S(C)(=O)=O.
What is the InChIKey of 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole?
The InChIKey is JLFUZLONGTXSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2O2S/c1-4-5(12(3,10)11)6(7)9(2)8-4/h1-3H3.
What are the key properties of 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole?
5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole has a molecular weight of 208.67 g/mol, XLogP of 0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-dimethyl-4-methylsulfonylpyrazole is sourced from PubChem (CID 20580525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).