About 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane
2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 20580663) has the molecular formula C29H32N2OSi
and a molecular weight of 452.67 g/mol. Its IUPAC name is 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| PubChem CID | 20580663 |
| Molecular Formula | C29H32N2OSi |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(/C=C/c2ccccc2)c2cc(/C=C/c3ccccc3)ccc21 |
| InChI | InChI=1S/C29H32N2OSi/c1-33(2,3)21-20-32-23-31-29-19-17-26(15-14-24-10-6-4-7-11-24)22-27(29)28(30-31)18-16-25-12-8-5-9-13-25/h4-19,22H,20-21,23H2,1-3H3/b15-14+,18-16+ |
| InChIKey | YWGHYCPUNKBIDG-IFABNPKTSA-N |
| XLogP | 7.69 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane (CID 20580663) is 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane is C[Si](C)(C)CCOCn1nc(/C=C/c2ccccc2)c2cc(/C=C/c3ccccc3)ccc21.
What is the InChIKey of 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane?
The InChIKey is YWGHYCPUNKBIDG-IFABNPKTSA-N. The full InChI is InChI=1S/C29H32N2OSi/c1-33(2,3)21-20-32-23-31-29-19-17-26(15-14-24-10-6-4-7-11-24)22-27(29)28(30-31)18-16-25-12-8-5-9-13-25/h4-19,22H,20-21,23H2,1-3H3/b15-14+,18-16+.
What are the key properties of 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane?
2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane has a molecular weight of 452.67 g/mol, XLogP of 7.69, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-bis[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane is sourced from PubChem (CID 20580663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).