C28H30ClN5O5S — CID 20580844
1-[2-[3-[(4-amino-3-chlorophenyl)sulfonylamino]-2-oxopiperidin-1-yl]acetyl]-N-naphthalen-2-ylpyrrolidine-2-carboxamide (PubChem CID 20580844) has the molecular formula C28H30ClN5O5S and a molecular weight of 584.10 g/mol. Its IUPAC name is 1-[2-[3-[(4-amino-3-chlorophenyl)sulfonylamino]-2-oxopiperidin-1-yl]acetyl]-N-naphthalen-2-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[3-[(4-amino-3-chlorophenyl)sulfonylamino]-2-oxopiperidin-1-yl]acetyl]-N-naphthalen-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 20580844 |
| Molecular Formula | C28H30ClN5O5S |
| Molecular Weight | 584.10 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | 1-[2-[3-[(4-amino-3-chlorophenyl)sulfonylamino]-2-oxopiperidin-1-yl]acetyl]-N-naphthalen-2-ylpyrrolidine-2-carboxamide |
| SMILES | Nc1ccc(S(=O)(=O)NC2CCCN(CC(=O)N3CCCC3C(=O)Nc3ccc4ccccc4c3)C2=O)cc1Cl |
| InChI | InChI=1S/C28H30ClN5O5S/c29-22-16-21(11-12-23(22)30)40(38,39)32-24-7-3-13-33(28(24)37)17-26(35)34-14-4-8-25(34)27(36)31-20-10-9-18-5-1-2-6-19(18)15-20/h1-2,5-6,9-12,15-16,24-25,32H,3-4,7-8,13-14,17,30H2,(H,31,36) |
| InChIKey | XZJMPAIRJLTOQY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.10 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|