About 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one
11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one (PubChem CID 20581474) has the molecular formula C11H15N2O+
and a molecular weight of 191.25 g/mol. Its IUPAC name is 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one.
Molecular Properties
| Compound Name | 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one |
| PubChem CID | 20581474 |
| Molecular Formula | C11H15N2O+ |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one |
| SMILES | O=C1CC=CC2=[N+]1CC1CNCC2C1 |
| InChI | InChI=1S/C11H15N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-2,8-9,12H,3-7H2/q+1 |
| InChIKey | BJRZKFHLEUPRBX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one?
The IUPAC name of 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one (CID 20581474) is 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one.
What is the SMILES notation for 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one?
The canonical SMILES for 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one is O=C1CC=CC2=[N+]1CC1CNCC2C1.
What is the InChIKey of 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one?
The InChIKey is BJRZKFHLEUPRBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-2,8-9,12H,3-7H2/q+1.
What are the key properties of 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one?
11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one has a molecular weight of 191.25 g/mol, XLogP of 0.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-aza-7-azoniatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one is sourced from PubChem (CID 20581474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).