About 3,4-bis(ethenyl)hexane-2,5-dithiol
3,4-bis(ethenyl)hexane-2,5-dithiol (PubChem CID 20581910) has the molecular formula C10H18S2
and a molecular weight of 202.39 g/mol. Its IUPAC name is 3,4-bis(ethenyl)hexane-2,5-dithiol.
Molecular Properties
| Compound Name | 3,4-bis(ethenyl)hexane-2,5-dithiol |
| PubChem CID | 20581910 |
| Molecular Formula | C10H18S2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3,4-bis(ethenyl)hexane-2,5-dithiol |
| SMILES | C=CC(C(C)S)C(C=C)C(C)S |
| InChI | InChI=1S/C10H18S2/c1-5-9(7(3)11)10(6-2)8(4)12/h5-12H,1-2H2,3-4H3 |
| InChIKey | CXCUJQKEFZWEEQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(ethenyl)hexane-2,5-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(ethenyl)hexane-2,5-dithiol?
The IUPAC name of 3,4-bis(ethenyl)hexane-2,5-dithiol (CID 20581910) is 3,4-bis(ethenyl)hexane-2,5-dithiol.
What is the SMILES notation for 3,4-bis(ethenyl)hexane-2,5-dithiol?
The canonical SMILES for 3,4-bis(ethenyl)hexane-2,5-dithiol is C=CC(C(C)S)C(C=C)C(C)S.
What is the InChIKey of 3,4-bis(ethenyl)hexane-2,5-dithiol?
The InChIKey is CXCUJQKEFZWEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18S2/c1-5-9(7(3)11)10(6-2)8(4)12/h5-12H,1-2H2,3-4H3.
What are the key properties of 3,4-bis(ethenyl)hexane-2,5-dithiol?
3,4-bis(ethenyl)hexane-2,5-dithiol has a molecular weight of 202.39 g/mol, XLogP of 3.23, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(ethenyl)hexane-2,5-dithiol is sourced from PubChem (CID 20581910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).