About (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one
(Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one (PubChem CID 2058197) has the molecular formula C8H6F3NOS
and a molecular weight of 221.20 g/mol. Its IUPAC name is (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one |
| PubChem CID | 2058197 |
| Molecular Formula | C8H6F3NOS |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one |
| SMILES | N/C(=C\C(=O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H6F3NOS/c9-8(10,11)7(12)4-5(13)6-2-1-3-14-6/h1-4H,12H2/b7-4- |
| InChIKey | QJDAORZUJBDJJF-DAXSKMNVSA-N |
| XLogP | 2.34 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one?
The IUPAC name of (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one (CID 2058197) is (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one.
What is the SMILES notation for (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one?
The canonical SMILES for (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one is N/C(=C\C(=O)c1cccs1)C(F)(F)F.
What is the InChIKey of (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one?
The InChIKey is QJDAORZUJBDJJF-DAXSKMNVSA-N. The full InChI is InChI=1S/C8H6F3NOS/c9-8(10,11)7(12)4-5(13)6-2-1-3-14-6/h1-4H,12H2/b7-4-.
What are the key properties of (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one?
(Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one has a molecular weight of 221.20 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one is sourced from PubChem (CID 2058197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).