About 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate
2-(2,4-dioxopyrimidin-1-yl)ethyl acetate (PubChem CID 2058214) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate |
| PubChem CID | 2058214 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate |
| SMILES | CC(=O)OCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O4/c1-6(11)14-5-4-10-3-2-7(12)9-8(10)13/h2-3H,4-5H2,1H3,(H,9,12,13) |
| InChIKey | SNXQZJMMWGGAEQ-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate?
The IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate (CID 2058214) is 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate.
What is the SMILES notation for 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate?
The canonical SMILES for 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate is CC(=O)OCCn1ccc(=O)[nH]c1=O.
What is the InChIKey of 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate?
The InChIKey is SNXQZJMMWGGAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-6(11)14-5-4-10-3-2-7(12)9-8(10)13/h2-3H,4-5H2,1H3,(H,9,12,13).
What are the key properties of 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate?
2-(2,4-dioxopyrimidin-1-yl)ethyl acetate has a molecular weight of 198.18 g/mol, XLogP of -0.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxopyrimidin-1-yl)ethyl acetate is sourced from PubChem (CID 2058214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).