C21H13O4S2- — CID 20582271
2-[(1E,3E,5E)-5-(1,3-dioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-oxo-1-benzothiophen-3-olate (PubChem CID 20582271) has the molecular formula C21H13O4S2- and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-5-(1,3-dioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-oxo-1-benzothiophen-3-olate.
| Compound Name | 2-[(1E,3E,5E)-5-(1,3-dioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-oxo-1-benzothiophen-3-olate |
|---|---|
| PubChem CID | 20582271 |
| Molecular Formula | C21H13O4S2- |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-[(1E,3E,5E)-5-(1,3-dioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-oxo-1-benzothiophen-3-olate |
| SMILES | O=C1/C(=C\C=C\C=C\C2=C([O-])c3ccccc3S2=O)S(=O)c2ccccc21 |
| InChI | InChI=1S/C21H14O4S2/c22-20-14-8-4-6-10-16(14)26(24)18(20)12-2-1-3-13-19-21(23)15-9-5-7-11-17(15)27(19)25/h1-13,22H/p-1/b3-1+,12-2+,19-13+ |
| InChIKey | UZAHHTDKQAZYHK-JPPIZABWSA-M |
| XLogP | 2.84 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|