C19H23N4O6- — CID 20582318
5-[(E)-3-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-1,3-diethyl-2,6-dioxopyrimidin-4-olate (PubChem CID 20582318) has the molecular formula C19H23N4O6- and a molecular weight of 403.42 g/mol. Its IUPAC name is 5-[(E)-3-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-1,3-diethyl-2,6-dioxopyrimidin-4-olate.
| Compound Name | 5-[(E)-3-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-1,3-diethyl-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 20582318 |
| Molecular Formula | C19H23N4O6- |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-[(E)-3-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]-1,3-diethyl-2,6-dioxopyrimidin-4-olate |
| SMILES | CCN1C(=O)C(=C/C=C/c2c([O-])n(CC)c(=O)n(CC)c2=O)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C19H24N4O6/c1-5-20-14(24)12(15(25)21(6-2)18(20)28)10-9-11-13-16(26)22(7-3)19(29)23(8-4)17(13)27/h9-11,24H,5-8H2,1-4H3/p-1/b10-9+ |
| InChIKey | FXAPQNHWBFIWAF-MDZDMXLPSA-M |
| XLogP | -0.11 |
| TPSA | 124.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|