C14H18N2O — CID 20583079
1,2,3,5,6,8-hexamethyl-1,7-naphthyridin-4-one (PubChem CID 20583079) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1,2,3,5,6,8-hexamethyl-1,7-naphthyridin-4-one.
| Compound Name | 1,2,3,5,6,8-hexamethyl-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 20583079 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1,2,3,5,6,8-hexamethyl-1,7-naphthyridin-4-one |
| SMILES | Cc1nc(C)c2c(c1C)c(=O)c(C)c(C)n2C |
| InChI | InChI=1S/C14H18N2O/c1-7-9(3)15-10(4)13-12(7)14(17)8(2)11(5)16(13)6/h1-6H3 |
| InChIKey | IFDSYAOEAWNBEL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |