C12H15N3O — CID 20583105
2,3,4,7,8-pentamethylpyrimido[1,2-a]pyrimidin-6-one (PubChem CID 20583105) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2,3,4,7,8-pentamethylpyrimido[1,2-a]pyrimidin-6-one.
| Compound Name | 2,3,4,7,8-pentamethylpyrimido[1,2-a]pyrimidin-6-one |
|---|---|
| PubChem CID | 20583105 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2,3,4,7,8-pentamethylpyrimido[1,2-a]pyrimidin-6-one |
| SMILES | Cc1nc2nc(C)c(C)c(=O)n2c(C)c1C |
| InChI | InChI=1S/C12H15N3O/c1-6-8(3)13-12-14-9(4)7(2)11(16)15(12)10(6)5/h1-5H3 |
| InChIKey | VQNNHYJJPCOICN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |