C13H16OS — CID 20583109
2,3,5,6,7-pentamethyl-1-benzothiophen-4-ol (PubChem CID 20583109) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 2,3,5,6,7-pentamethyl-1-benzothiophen-4-ol.
| Compound Name | 2,3,5,6,7-pentamethyl-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 20583109 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2,3,5,6,7-pentamethyl-1-benzothiophen-4-ol |
| SMILES | Cc1sc2c(C)c(C)c(C)c(O)c2c1C |
| InChI | InChI=1S/C13H16OS/c1-6-7(2)12(14)11-9(4)10(5)15-13(11)8(6)3/h14H,1-5H3 |
| InChIKey | XZFHALHVTDBANP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |