C6H14N2S — CID 20583494
2,3,4,5-tetramethyl-1,2,5-thiadiazolidine (PubChem CID 20583494) has the molecular formula C6H14N2S and a molecular weight of 146.26 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-1,2,5-thiadiazolidine.
| Compound Name | 2,3,4,5-tetramethyl-1,2,5-thiadiazolidine |
|---|---|
| PubChem CID | 20583494 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2,3,4,5-tetramethyl-1,2,5-thiadiazolidine |
| SMILES | CC1C(C)N(C)SN1C |
| InChI | InChI=1S/C6H14N2S/c1-5-6(2)8(4)9-7(5)3/h5-6H,1-4H3 |
| InChIKey | MYBIQMORCGPXHX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|