About 3,4-dimethyl-1,2,5-thiadiazolidine
3,4-dimethyl-1,2,5-thiadiazolidine (PubChem CID 20583503) has the molecular formula C4H10N2S
and a molecular weight of 118.20 g/mol. Its IUPAC name is 3,4-dimethyl-1,2,5-thiadiazolidine.
Molecular Properties
| Compound Name | 3,4-dimethyl-1,2,5-thiadiazolidine |
| PubChem CID | 20583503 |
| Molecular Formula | C4H10N2S |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 3,4-dimethyl-1,2,5-thiadiazolidine |
| SMILES | CC1NSNC1C |
| InChI | InChI=1S/C4H10N2S/c1-3-4(2)6-7-5-3/h3-6H,1-2H3 |
| InChIKey | CWFUNHNLYSCDGQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-1,2,5-thiadiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1,2,5-thiadiazolidine?
The IUPAC name of 3,4-dimethyl-1,2,5-thiadiazolidine (CID 20583503) is 3,4-dimethyl-1,2,5-thiadiazolidine.
What is the SMILES notation for 3,4-dimethyl-1,2,5-thiadiazolidine?
The canonical SMILES for 3,4-dimethyl-1,2,5-thiadiazolidine is CC1NSNC1C.
What is the InChIKey of 3,4-dimethyl-1,2,5-thiadiazolidine?
The InChIKey is CWFUNHNLYSCDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2S/c1-3-4(2)6-7-5-3/h3-6H,1-2H3.
What are the key properties of 3,4-dimethyl-1,2,5-thiadiazolidine?
3,4-dimethyl-1,2,5-thiadiazolidine has a molecular weight of 118.20 g/mol, XLogP of 0.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1,2,5-thiadiazolidine is sourced from PubChem (CID 20583503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).