C16H16FN2O3+ — CID 20583963
carboxymethyl-[3-(9-fluoronona-2,4,6,8-tetraynoylamino)propyl]-dimethylazanium (PubChem CID 20583963) has the molecular formula C16H16FN2O3+ and a molecular weight of 303.31 g/mol. Its IUPAC name is carboxymethyl-[3-(9-fluoronona-2,4,6,8-tetraynoylamino)propyl]-dimethylazanium.
| Compound Name | carboxymethyl-[3-(9-fluoronona-2,4,6,8-tetraynoylamino)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 20583963 |
| Molecular Formula | C16H16FN2O3+ |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | carboxymethyl-[3-(9-fluoronona-2,4,6,8-tetraynoylamino)propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCNC(=O)C#CC#CC#CC#CF)CC(=O)O |
| InChI | InChI=1S/C16H15FN2O3/c1-19(2,14-16(21)22)13-9-12-18-15(20)10-7-5-3-4-6-8-11-17/h9,12-14H2,1-2H3,(H-,18,20,21,22)/p+1 |
| InChIKey | AUQWSQXLMAXVLO-UHFFFAOYSA-O |
| XLogP | -0.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|