C15H22N2O3 — CID 2058502
1,3-dicyclohexylimidazolidine-2,4,5-trione (PubChem CID 2058502) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1,3-dicyclohexylimidazolidine-2,4,5-trione.
| Compound Name | 1,3-dicyclohexylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 2058502 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1,3-dicyclohexylimidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C15H22N2O3/c18-13-14(19)17(12-9-5-2-6-10-12)15(20)16(13)11-7-3-1-4-8-11/h11-12H,1-10H2 |
| InChIKey | SKVNURXOPBKIGV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|