C20H26N2 — CID 20585150
3-[(8aR)-6-methyl-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-propan-2-yl-1H-indole (PubChem CID 20585150) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-[(8aR)-6-methyl-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-propan-2-yl-1H-indole.
| Compound Name | 3-[(8aR)-6-methyl-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 20585150 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-[(8aR)-6-methyl-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-propan-2-yl-1H-indole |
| SMILES | CC1=C(c2c[nH]c3ccc(C(C)C)cc23)C[C@H]2CCCN2C1 |
| InChI | InChI=1S/C20H26N2/c1-13(2)15-6-7-20-18(9-15)19(11-21-20)17-10-16-5-4-8-22(16)12-14(17)3/h6-7,9,11,13,16,21H,4-5,8,10,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | PSZNJFHSYNTSPQ-MRXNPFEDSA-N |
| XLogP | 4.93 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |