C25H23ClFNO8S2 — CID 20585650
(2-oxo-2-phenylmethoxyethyl) 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate (PubChem CID 20585650) has the molecular formula C25H23ClFNO8S2 and a molecular weight of 584.04 g/mol. Its IUPAC name is (2-oxo-2-phenylmethoxyethyl) 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate.
| Compound Name | (2-oxo-2-phenylmethoxyethyl) 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 20585650 |
| Molecular Formula | C25H23ClFNO8S2 |
| Molecular Weight | 584.04 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | (2-oxo-2-phenylmethoxyethyl) 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate |
| SMILES | CC1=C(C(=O)OCC(=O)OCc2ccccc2)C(c2c(F)cccc2Cl)C2=C(CS(=O)(=O)CCS2(=O)=O)N1 |
| InChI | InChI=1S/C25H23ClFNO8S2/c1-15-21(25(30)36-13-20(29)35-12-16-6-3-2-4-7-16)23(22-17(26)8-5-9-18(22)27)24-19(28-15)14-37(31,32)10-11-38(24,33)34/h2-9,23,28H,10-14H2,1H3 |
| InChIKey | WOLQLBVJGSUFHL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.04 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |