C17H19ClN4O — CID 20585754
2-[2-(chloromethyl)-5-isocyanobenzimidazol-1-yl]-N-cyclohexylacetamide (PubChem CID 20585754) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-5-isocyanobenzimidazol-1-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[2-(chloromethyl)-5-isocyanobenzimidazol-1-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 20585754 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-[2-(chloromethyl)-5-isocyanobenzimidazol-1-yl]-N-cyclohexylacetamide |
| SMILES | [C-]#[N+]c1ccc2c(c1)nc(CCl)n2CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H19ClN4O/c1-19-13-7-8-15-14(9-13)21-16(10-18)22(15)11-17(23)20-12-5-3-2-4-6-12/h7-9,12H,2-6,10-11H2,(H,20,23) |
| InChIKey | WIMGFIXHNGSATH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|