C22H29N5O — CID 20585859
7-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 20585859) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 7-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | 7-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 20585859 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 7-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCc2ccc(OCC3CCN(c4ccc(C)cn4)CC3)cc2C1 |
| InChI | InChI=1S/C22H29N5O/c1-16-2-5-21(25-13-16)26-9-6-17(7-10-26)15-28-20-4-3-18-8-11-27(22(23)24)14-19(18)12-20/h2-5,12-13,17H,6-11,14-15H2,1H3,(H3,23,24) |
| InChIKey | UGEFMAIUBZBMGF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|