About 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene
2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene (PubChem CID 20585933) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene.
Molecular Properties
| Compound Name | 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene |
| PubChem CID | 20585933 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene |
| SMILES | C=C/C=C/c1c(C)ccc(C)c1C |
| InChI | InChI=1S/C13H16/c1-5-6-7-13-11(3)9-8-10(2)12(13)4/h5-9H,1H2,2-4H3/b7-6+ |
| InChIKey | CBIAGJZZVUQDOC-VOTSOKGWSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene?
The IUPAC name of 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene (CID 20585933) is 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene.
What is the SMILES notation for 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene?
The canonical SMILES for 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene is C=C/C=C/c1c(C)ccc(C)c1C.
What is the InChIKey of 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene?
The InChIKey is CBIAGJZZVUQDOC-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H16/c1-5-6-7-13-11(3)9-8-10(2)12(13)4/h5-9H,1H2,2-4H3/b7-6+.
What are the key properties of 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene?
2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene has a molecular weight of 172.27 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-buta-1,3-dienyl]-1,3,4-trimethylbenzene is sourced from PubChem (CID 20585933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).