C35H34FN3O2 — CID 20586106
(2-fluorophenyl) N-[6-(2-methyl-4,5-diphenylimidazol-1-yl)-1-phenylhexyl]carbamate (PubChem CID 20586106) has the molecular formula C35H34FN3O2 and a molecular weight of 547.67 g/mol. Its IUPAC name is (2-fluorophenyl) N-[6-(2-methyl-4,5-diphenylimidazol-1-yl)-1-phenylhexyl]carbamate.
| Compound Name | (2-fluorophenyl) N-[6-(2-methyl-4,5-diphenylimidazol-1-yl)-1-phenylhexyl]carbamate |
|---|---|
| PubChem CID | 20586106 |
| Molecular Formula | C35H34FN3O2 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | (2-fluorophenyl) N-[6-(2-methyl-4,5-diphenylimidazol-1-yl)-1-phenylhexyl]carbamate |
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccccc2)n1CCCCCC(NC(=O)Oc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C35H34FN3O2/c1-26-37-33(28-18-8-3-9-19-28)34(29-20-10-4-11-21-29)39(26)25-15-5-12-23-31(27-16-6-2-7-17-27)38-35(40)41-32-24-14-13-22-30(32)36/h2-4,6-11,13-14,16-22,24,31H,5,12,15,23,25H2,1H3,(H,38,40) |
| InChIKey | LVGPJSBRMDHIRR-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|