C15H26N4O3 — CID 20586283
(3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(hydrazinylmethylideneamino)cyclopentene-1-carboxylic acid (PubChem CID 20586283) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is (3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(hydrazinylmethylideneamino)cyclopentene-1-carboxylic acid.
| Compound Name | (3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(hydrazinylmethylideneamino)cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 20586283 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(hydrazinylmethylideneamino)cyclopentene-1-carboxylic acid |
| SMILES | CCC(CC)[C@H](NC(C)=O)[C@@H]1C=C(C(=O)O)C[C@H]1/N=C/NN |
| InChI | InChI=1S/C15H26N4O3/c1-4-10(5-2)14(19-9(3)20)12-6-11(15(21)22)7-13(12)17-8-18-16/h6,8,10,12-14H,4-5,7,16H2,1-3H3,(H,17,18)(H,19,20)(H,21,22)/t12-,13-,14+/m1/s1 |
| InChIKey | DJSNAKWPNWHMMC-MCIONIFRSA-N |
| XLogP | 0.82 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|