About 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione
3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione (PubChem CID 20586614) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione.
Molecular Properties
| Compound Name | 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione |
| PubChem CID | 20586614 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione |
| SMILES | CCC(C)C1CN(C(C)=O)C(=O)OC1=O |
| InChI | InChI=1S/C10H15NO4/c1-4-6(2)8-5-11(7(3)12)10(14)15-9(8)13/h6,8H,4-5H2,1-3H3 |
| InChIKey | CLYALTKOTPSIBL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione?
The IUPAC name of 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione (CID 20586614) is 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione.
What is the SMILES notation for 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione?
The canonical SMILES for 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione is CCC(C)C1CN(C(C)=O)C(=O)OC1=O.
What is the InChIKey of 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione?
The InChIKey is CLYALTKOTPSIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c1-4-6(2)8-5-11(7(3)12)10(14)15-9(8)13/h6,8H,4-5H2,1-3H3.
What are the key properties of 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione?
3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione has a molecular weight of 213.23 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-5-butan-2-yl-1,3-oxazinane-2,6-dione is sourced from PubChem (CID 20586614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).