C16H16F20O3Si — CID 20586803
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluoro-11-methyldodecyl)-trimethoxysilane (PubChem CID 20586803) has the molecular formula C16H16F20O3Si and a molecular weight of 664.35 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluoro-11-methyldodecyl)-trimethoxysilane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluoro-11-methyldodecyl)-trimethoxysilane |
|---|---|
| PubChem CID | 20586803 |
| Molecular Formula | C16H16F20O3Si |
| Molecular Weight | 664.35 g/mol |
| Exact Mass | 664.05 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluoro-11-methyldodecyl)-trimethoxysilane |
| SMILES | CO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)C(F)(F)F)(OC)OC |
| InChI | InChI=1S/C16H16F20O3Si/c1-7(17,16(34,35)36)9(20,21)11(24,25)13(28,29)15(32,33)14(30,31)12(26,27)10(22,23)8(18,19)5-6-40(37-2,38-3)39-4/h5-6H2,1-4H3 |
| InChIKey | JBSJESPAWOJLHD-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.35 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|