About 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine
2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine (PubChem CID 20587029) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine |
| PubChem CID | 20587029 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine |
| SMILES | C1=CCNC(C2C=CC=CN2)=C1 |
| InChI | InChI=1S/C10H12N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-7,9,11-12H,8H2 |
| InChIKey | KXUKXFGKMFERHQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine?
The IUPAC name of 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine (CID 20587029) is 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine?
The canonical SMILES for 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine is C1=CCNC(C2C=CC=CN2)=C1.
What is the InChIKey of 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine?
The InChIKey is KXUKXFGKMFERHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-7,9,11-12H,8H2.
What are the key properties of 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine?
2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine has a molecular weight of 160.22 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydropyridin-6-yl)-1,2-dihydropyridine is sourced from PubChem (CID 20587029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).