C22H36O3 — CID 20587123
tert-butyl 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxybutanoate (PubChem CID 20587123) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is tert-butyl 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxybutanoate.
| Compound Name | tert-butyl 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 20587123 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | tert-butyl 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxybutanoate |
| SMILES | CC1C(C)C2CC1C1C3CC(C21)C(C(C)(O)CC(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C22H36O3/c1-11-12(2)15-9-14(11)19-13-7-16(20(15)19)17(8-13)22(6,24)10-18(23)25-21(3,4)5/h11-17,19-20,24H,7-10H2,1-6H3 |
| InChIKey | USLCENUMZAOEDC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|