About tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate
tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate (PubChem CID 20587124) has the molecular formula C21H32O2
and a molecular weight of 316.49 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate.
Molecular Properties
| Compound Name | tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate |
| PubChem CID | 20587124 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate |
| SMILES | CC(C)(C)OC(=O)CC(C)(C)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C21H32O2/c1-20(2,3)23-17(22)11-21(4,5)16-10-14-9-15(16)19-13-7-6-12(8-13)18(14)19/h6-7,12-16,18-19H,8-11H2,1-5H3 |
| InChIKey | PCEKLWPUPMZFRT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate?
The IUPAC name of tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate (CID 20587124) is tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate.
What is the SMILES notation for tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate?
The canonical SMILES for tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate is CC(C)(C)OC(=O)CC(C)(C)C1CC2CC1C1C3C=CC(C3)C21.
What is the InChIKey of tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate?
The InChIKey is PCEKLWPUPMZFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O2/c1-20(2,3)23-17(22)11-21(4,5)16-10-14-9-15(16)19-13-7-6-12(8-13)18(14)19/h6-7,12-16,18-19H,8-11H2,1-5H3.
What are the key properties of tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate?
tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate has a molecular weight of 316.49 g/mol, XLogP of 4.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)butanoate is sourced from PubChem (CID 20587124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).