About tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate
tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate (PubChem CID 20587125) has the molecular formula C19H32O3
and a molecular weight of 308.46 g/mol. Its IUPAC name is tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate |
| PubChem CID | 20587125 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate |
| SMILES | CC1C2CC(C1C)C1(CCCC1(O)CC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C19H32O3/c1-12-13(2)15-9-14(12)10-18(15)7-6-8-19(18,21)11-16(20)22-17(3,4)5/h12-15,21H,6-11H2,1-5H3 |
| InChIKey | HDANOHLQGPUIBG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate?
The IUPAC name of tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate (CID 20587125) is tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate.
What is the SMILES notation for tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate?
The canonical SMILES for tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate is CC1C2CC(C1C)C1(CCCC1(O)CC(=O)OC(C)(C)C)C2.
What is the InChIKey of tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate?
The InChIKey is HDANOHLQGPUIBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O3/c1-12-13(2)15-9-14(12)10-18(15)7-6-8-19(18,21)11-16(20)22-17(3,4)5/h12-15,21H,6-11H2,1-5H3.
What are the key properties of tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate?
tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate has a molecular weight of 308.46 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(1'-hydroxy-5,6-dimethylspiro[bicyclo[2.2.1]heptane-2,2'-cyclopentane]-1'-yl)acetate is sourced from PubChem (CID 20587125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).