About 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate
2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate (PubChem CID 20587133) has the molecular formula C23H38O4
and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate.
Molecular Properties
| Compound Name | 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate |
| PubChem CID | 20587133 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate |
| SMILES | CC(=O)OC(CC(=O)OC(C)(C)C1CCCCC1)C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C23H38O4/c1-14-15(2)19-11-17(14)12-20(19)21(26-16(3)24)13-22(25)27-23(4,5)18-9-7-6-8-10-18/h14-15,17-21H,6-13H2,1-5H3 |
| InChIKey | MRZPGZCBSQPIDJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The IUPAC name of 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate (CID 20587133) is 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate.
What is the SMILES notation for 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The canonical SMILES for 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate is CC(=O)OC(CC(=O)OC(C)(C)C1CCCCC1)C1CC2CC1C(C)C2C.
What is the InChIKey of 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The InChIKey is MRZPGZCBSQPIDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38O4/c1-14-15(2)19-11-17(14)12-20(19)21(26-16(3)24)13-22(25)27-23(4,5)18-9-7-6-8-10-18/h14-15,17-21H,6-13H2,1-5H3.
What are the key properties of 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate has a molecular weight of 378.55 g/mol, XLogP of 5.14, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpropan-2-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate is sourced from PubChem (CID 20587133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).