About (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate
(1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate (PubChem CID 20587134) has the molecular formula C25H40O4
and a molecular weight of 404.59 g/mol. Its IUPAC name is (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate.
Molecular Properties
| Compound Name | (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate |
| PubChem CID | 20587134 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate |
| SMILES | CC(=O)OC(CC(=O)OC1(C2CCCCC2)CCCC1)C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C25H40O4/c1-16-17(2)21-13-19(16)14-22(21)23(28-18(3)26)15-24(27)29-25(11-7-8-12-25)20-9-5-4-6-10-20/h16-17,19-23H,4-15H2,1-3H3 |
| InChIKey | NMDHGLISEBZNRT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The IUPAC name of (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate (CID 20587134) is (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate.
What is the SMILES notation for (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The canonical SMILES for (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate is CC(=O)OC(CC(=O)OC1(C2CCCCC2)CCCC1)C1CC2CC1C(C)C2C.
What is the InChIKey of (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The InChIKey is NMDHGLISEBZNRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40O4/c1-16-17(2)21-13-19(16)14-22(21)23(28-18(3)26)15-24(27)29-25(11-7-8-12-25)20-9-5-4-6-10-20/h16-17,19-23H,4-15H2,1-3H3.
What are the key properties of (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
(1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate has a molecular weight of 404.59 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexylcyclopentyl) 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate is sourced from PubChem (CID 20587134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).