About 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate
3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate (PubChem CID 20587135) has the molecular formula C20H34O4
and a molecular weight of 338.49 g/mol. Its IUPAC name is 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate.
Molecular Properties
| Compound Name | 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate |
| PubChem CID | 20587135 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate |
| SMILES | CCC(C)(CC)OC(=O)CC(OC(C)=O)C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C20H34O4/c1-7-20(6,8-2)24-19(22)11-18(23-14(5)21)17-10-15-9-16(17)13(4)12(15)3/h12-13,15-18H,7-11H2,1-6H3 |
| InChIKey | KHUQLBURQBONFL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The IUPAC name of 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate (CID 20587135) is 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate.
What is the SMILES notation for 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The canonical SMILES for 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate is CCC(C)(CC)OC(=O)CC(OC(C)=O)C1CC2CC1C(C)C2C.
What is the InChIKey of 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
The InChIKey is KHUQLBURQBONFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O4/c1-7-20(6,8-2)24-19(22)11-18(23-14(5)21)17-10-15-9-16(17)13(4)12(15)3/h12-13,15-18H,7-11H2,1-6H3.
What are the key properties of 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate?
3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate has a molecular weight of 338.49 g/mol, XLogP of 4.36, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentan-3-yl 3-acetyloxy-3-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate is sourced from PubChem (CID 20587135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).