C23H36O4 — CID 20587139
tert-butyl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate (PubChem CID 20587139) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate.
| Compound Name | tert-butyl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate |
|---|---|
| PubChem CID | 20587139 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | tert-butyl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate |
| SMILES | CC(=O)OC(CC(=O)OC(C)(C)C)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C23H36O4/c1-11-12(2)16-9-15(11)21-14-7-17(18(8-14)22(16)21)19(26-13(3)24)10-20(25)27-23(4,5)6/h11-12,14-19,21-22H,7-10H2,1-6H3 |
| InChIKey | XBKVGDNIPSBMCK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|