C32H22N6O2 — CID 20587585
22-(8-aminoisoquinolin-3-yl)-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid (PubChem CID 20587585) has the molecular formula C32H22N6O2 and a molecular weight of 522.57 g/mol. Its IUPAC name is 22-(8-aminoisoquinolin-3-yl)-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid.
| Compound Name | 22-(8-aminoisoquinolin-3-yl)-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid |
|---|---|
| PubChem CID | 20587585 |
| Molecular Formula | C32H22N6O2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 22-(8-aminoisoquinolin-3-yl)-2,5,23,26-tetrazahexacyclo[12.12.0.03,12.04,9.016,25.019,24]hexacosa-1(26),2,4(9),5,7,12,14,16(25),19(24),20,22-undecaene-6-carboxylic acid |
| SMILES | Nc1cccc2cc(-c3ccc4c(n3)-c3nc5nc6c(cc5cc3CC4)CCc3ccc(C(=O)O)nc3-6)ncc12 |
| InChI | InChI=1S/C32H22N6O2/c33-23-3-1-2-18-14-26(34-15-22(18)23)24-10-8-16-4-6-19-12-21-13-20-7-5-17-9-11-25(32(39)40)36-28(17)30(20)38-31(21)37-29(19)27(16)35-24/h1-3,8-15H,4-7,33H2,(H,39,40) |
| InChIKey | ZRHWZZWINGHOBA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|