C28H16N4O4 — CID 20587611
6,21-dimethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(28),2,4(9),5,7,12(29),13,15(30),16,18(23),19,21,26-tridecaene-11,25-dione (PubChem CID 20587611) has the molecular formula C28H16N4O4 and a molecular weight of 472.46 g/mol. Its IUPAC name is 6,21-dimethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(28),2,4(9),5,7,12(29),13,15(30),16,18(23),19,21,26-tridecaene-11,25-dione.
| Compound Name | 6,21-dimethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(28),2,4(9),5,7,12(29),13,15(30),16,18(23),19,21,26-tridecaene-11,25-dione |
|---|---|
| PubChem CID | 20587611 |
| Molecular Formula | C28H16N4O4 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 6,21-dimethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(28),2,4(9),5,7,12(29),13,15(30),16,18(23),19,21,26-tridecaene-11,25-dione |
| SMILES | COc1ccc2c(c1)nc1c3ccc4c(=O)n5c6cc(OC)ccc6nc5c5ccc(c(=O)n21)c3c45 |
| InChI | InChI=1S/C28H16N4O4/c1-35-13-4-10-21-20(11-13)30-26-16-6-8-18-23-15(5-7-17(24(16)23)27(33)31(21)26)25-29-19-9-3-14(36-2)12-22(19)32(25)28(18)34/h3-12H,1-2H3 |
| InChIKey | ISTDNBYWCKYATP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|