About acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+)
acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) (PubChem CID 20587644) has the molecular formula C10H20O4SiW
and a molecular weight of 416.19 g/mol. Its IUPAC name is acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+).
Molecular Properties
| Compound Name | acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) |
| PubChem CID | 20587644 |
| Molecular Formula | C10H20O4SiW |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) |
| SMILES | [CH2-]C(=O)O.[CH2-]C(CC[Si](C)(C)C)C(=O)O.[W+2] |
| InChI | InChI=1S/C8H17O2Si.C2H3O2.W/c1-7(8(9)10)5-6-11(2,3)4;1-2(3)4;/h7H,1,5-6H2,2-4H3,(H,9,10);1H2,(H,3,4);/q2*-1;+2 |
| InChIKey | MJYMCTUYAZGSTC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+)?
The IUPAC name of acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) (CID 20587644) is acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+).
What is the SMILES notation for acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+)?
The canonical SMILES for acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) is [CH2-]C(=O)O.[CH2-]C(CC[Si](C)(C)C)C(=O)O.[W+2].
What is the InChIKey of acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+)?
The InChIKey is MJYMCTUYAZGSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O2Si.C2H3O2.W/c1-7(8(9)10)5-6-11(2,3)4;1-2(3)4;/h7H,1,5-6H2,2-4H3,(H,9,10);1H2,(H,3,4);/q2*-1;+2.
What are the key properties of acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+)?
acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) has a molecular weight of 416.19 g/mol, XLogP of 2.15, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methanidyl-4-trimethylsilylbutanoic acid;tungsten(2+) is sourced from PubChem (CID 20587644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).