About 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one
6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 20587845) has the molecular formula C16H17F3N2O
and a molecular weight of 310.32 g/mol. Its IUPAC name is 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one |
| PubChem CID | 20587845 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | C[C@@H]1CC[C@H](C)N1c1ccc2[nH]c(=O)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C16H17F3N2O/c1-9-3-4-10(2)21(9)11-5-6-14-12(7-11)13(16(17,18)19)8-15(22)20-14/h5-10H,3-4H2,1-2H3,(H,20,22)/t9-,10+ |
| InChIKey | YSOHSFXHNXOZIE-AOOOYVTPSA-N |
| XLogP | 3.92 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one?
The IUPAC name of 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one (CID 20587845) is 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one.
What is the SMILES notation for 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one?
The canonical SMILES for 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one is C[C@@H]1CC[C@H](C)N1c1ccc2[nH]c(=O)cc(C(F)(F)F)c2c1.
What is the InChIKey of 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one?
The InChIKey is YSOHSFXHNXOZIE-AOOOYVTPSA-N. The full InChI is InChI=1S/C16H17F3N2O/c1-9-3-4-10(2)21(9)11-5-6-14-12(7-11)13(16(17,18)19)8-15(22)20-14/h5-10H,3-4H2,1-2H3,(H,20,22)/t9-,10+.
What are the key properties of 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one?
6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one has a molecular weight of 310.32 g/mol, XLogP of 3.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-4-(trifluoromethyl)-1H-quinolin-2-one is sourced from PubChem (CID 20587845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).