About [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate
[2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate (PubChem CID 20588101) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate.
Molecular Properties
| Compound Name | [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate |
| PubChem CID | 20588101 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate |
| SMILES | C=C(C)C(=O)CC(COCCCC)COC(=O)C(C)=O |
| InChI | InChI=1S/C15H24O5/c1-5-6-7-19-9-13(8-14(17)11(2)3)10-20-15(18)12(4)16/h13H,2,5-10H2,1,3-4H3 |
| InChIKey | ANLMXMNCUGVCNU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate?
The IUPAC name of [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate (CID 20588101) is [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate.
What is the SMILES notation for [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate?
The canonical SMILES for [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate is C=C(C)C(=O)CC(COCCCC)COC(=O)C(C)=O.
What is the InChIKey of [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate?
The InChIKey is ANLMXMNCUGVCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O5/c1-5-6-7-19-9-13(8-14(17)11(2)3)10-20-15(18)12(4)16/h13H,2,5-10H2,1,3-4H3.
What are the key properties of [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate?
[2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate has a molecular weight of 284.35 g/mol, XLogP of 2.09, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(butoxymethyl)-5-methyl-4-oxohex-5-enyl] 2-oxopropanoate is sourced from PubChem (CID 20588101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).