C10H11N5O4 — CID 2058811
butyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 2058811) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is butyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | butyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 2058811 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | butyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CCCCOC(=O)c1nc2ncc([N+](=O)[O-])cn2n1 |
| InChI | InChI=1S/C10H11N5O4/c1-2-3-4-19-9(16)8-12-10-11-5-7(15(17)18)6-14(10)13-8/h5-6H,2-4H2,1H3 |
| InChIKey | TZRKXKXEGQSELW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|