C23H37NO4 — CID 20588145
2,2,6,6-tetramethyl-1-[1-[2-(oxiran-2-ylmethoxy)phenyl]ethoxy]-4-propoxypiperidine (PubChem CID 20588145) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[1-[2-(oxiran-2-ylmethoxy)phenyl]ethoxy]-4-propoxypiperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[1-[2-(oxiran-2-ylmethoxy)phenyl]ethoxy]-4-propoxypiperidine |
|---|---|
| PubChem CID | 20588145 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[1-[2-(oxiran-2-ylmethoxy)phenyl]ethoxy]-4-propoxypiperidine |
| SMILES | CCCOC1CC(C)(C)N(OC(C)c2ccccc2OCC2CO2)C(C)(C)C1 |
| InChI | InChI=1S/C23H37NO4/c1-7-12-25-18-13-22(3,4)24(23(5,6)14-18)28-17(2)20-10-8-9-11-21(20)27-16-19-15-26-19/h8-11,17-19H,7,12-16H2,1-6H3 |
| InChIKey | TXPAUNZYDYVHJS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|